About 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane
2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane (PubChem CID 157453335) has the molecular formula C22H33BrF2N2Sn
and a molecular weight of 562.13 g/mol. Its IUPAC name is 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane.
Molecular Properties
| Compound Name | 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane |
| PubChem CID | 157453335 |
| Molecular Formula | C22H33BrF2N2Sn |
| Molecular Weight | 562.13 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(F)cn1.Fc1ccc(Br)nc1 |
| InChI | InChI=1S/C5H3BrFN.C5H3FN.3C4H9.Sn/c6-5-2-1-4(7)3-8-5;6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-3H;1-2,4H;3*1,3-4H2,2H3; |
| InChIKey | BTBAVKZEHCKYOT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.13 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane?
The IUPAC name of 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane (CID 157453335) is 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane.
What is the SMILES notation for 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane?
The canonical SMILES for 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane is CCCC[Sn](CCCC)(CCCC)c1ccc(F)cn1.Fc1ccc(Br)nc1.
What is the InChIKey of 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane?
The InChIKey is BTBAVKZEHCKYOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrFN.C5H3FN.3C4H9.Sn/c6-5-2-1-4(7)3-8-5;6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-3H;1-2,4H;3*1,3-4H2,2H3;.
What are the key properties of 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane?
2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane has a molecular weight of 562.13 g/mol, XLogP of 7.26, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-fluoropyridine;tributyl-(5-fluoro-2-pyridinyl)stannane is sourced from PubChem (CID 157453335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).