C32H26Cl2N6O6 — CID 157454740
3-[2-(3-chloro-2-nitrophenyl)benzimidazol-1-yl]propane-1,2-diol;2-(3-chloro-2-nitrophenyl)-1-prop-2-enylbenzimidazole (PubChem CID 157454740) has the molecular formula C32H26Cl2N6O6 and a molecular weight of 661.50 g/mol. Its IUPAC name is 3-[2-(3-chloro-2-nitrophenyl)benzimidazol-1-yl]propane-1,2-diol;2-(3-chloro-2-nitrophenyl)-1-prop-2-enylbenzimidazole.
| Compound Name | 3-[2-(3-chloro-2-nitrophenyl)benzimidazol-1-yl]propane-1,2-diol;2-(3-chloro-2-nitrophenyl)-1-prop-2-enylbenzimidazole |
|---|---|
| PubChem CID | 157454740 |
| Molecular Formula | C32H26Cl2N6O6 |
| Molecular Weight | 661.50 g/mol |
| Exact Mass | 660.13 |
| IUPAC Name | 3-[2-(3-chloro-2-nitrophenyl)benzimidazol-1-yl]propane-1,2-diol;2-(3-chloro-2-nitrophenyl)-1-prop-2-enylbenzimidazole |
| SMILES | C=CCn1c(-c2cccc(Cl)c2[N+](=O)[O-])nc2ccccc21.O=[N+]([O-])c1c(Cl)cccc1-c1nc2ccccc2n1CC(O)CO |
| InChI | InChI=1S/C16H14ClN3O4.C16H12ClN3O2/c17-12-5-3-4-11(15(12)20(23)24)16-18-13-6-1-2-7-14(13)19(16)8-10(22)9-21;1-2-10-19-14-9-4-3-8-13(14)18-16(19)11-6-5-7-12(17)15(11)20(21)22/h1-7,10,21-22H,8-9H2;2-9H,1,10H2 |
| InChIKey | BTFLCSAOQFVBKN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|