C34H32ClN5O5S3 — CID 157455506
ethyl 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate;ethyl 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate (PubChem CID 157455506) has the molecular formula C34H32ClN5O5S3 and a molecular weight of 722.31 g/mol. Its IUPAC name is ethyl 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate;ethyl 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | ethyl 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate;ethyl 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 157455506 |
| Molecular Formula | C34H32ClN5O5S3 |
| Molecular Weight | 722.31 g/mol |
| Exact Mass | 721.13 |
| IUPAC Name | ethyl 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate;ethyl 4-[(2-oxo-3H-1-benzothiophen-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(sc3ncnc(Cl)c23)C1.CCOC(=O)C1CCc2c(sc3ncnc(Nc4ccc5c(c4)SC(=O)C5)c23)C1 |
| InChI | InChI=1S/C21H19N3O3S2.C13H13ClN2O2S/c1-2-27-21(26)12-4-6-14-16(7-12)29-20-18(14)19(22-10-23-20)24-13-5-3-11-8-17(25)28-15(11)9-13;1-2-18-13(17)7-3-4-8-9(5-7)19-12-10(8)11(14)15-6-16-12/h3,5,9-10,12H,2,4,6-8H2,1H3,(H,22,23,24);6-7H,2-5H2,1H3 |
| InChIKey | BTHQERPSKZJIRB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.31 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|