C11H18F3N5O — CID 157455900
N-(6-aminohexyl)acetamide;2,4,6-trifluoro-1,3,5-triazine (PubChem CID 157455900) has the molecular formula C11H18F3N5O and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(6-aminohexyl)acetamide;2,4,6-trifluoro-1,3,5-triazine.
| Compound Name | N-(6-aminohexyl)acetamide;2,4,6-trifluoro-1,3,5-triazine |
|---|---|
| PubChem CID | 157455900 |
| Molecular Formula | C11H18F3N5O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(6-aminohexyl)acetamide;2,4,6-trifluoro-1,3,5-triazine |
| SMILES | CC(=O)NCCCCCCN.Fc1nc(F)nc(F)n1 |
| InChI | InChI=1S/C8H18N2O.C3F3N3/c1-8(11)10-7-5-3-2-4-6-9;4-1-7-2(5)9-3(6)8-1/h2-7,9H2,1H3,(H,10,11); |
| InChIKey | BTIUVLWYMSMKAU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|