About methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one
methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one (PubChem CID 157457109) has the molecular formula C11H24O3
and a molecular weight of 204.31 g/mol. Its IUPAC name is methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one.
Molecular Properties
| Compound Name | methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one |
| PubChem CID | 157457109 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one |
| SMILES | C.C.CC(=O)CCC1(C)COCOC1 |
| InChI | InChI=1S/C9H16O3.2CH4/c1-8(10)3-4-9(2)5-11-7-12-6-9;;/h3-7H2,1-2H3;2*1H4 |
| InChIKey | BTMJUUGRAQFLTK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one?
The IUPAC name of methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one (CID 157457109) is methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one.
What is the SMILES notation for methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one?
The canonical SMILES for methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one is C.C.CC(=O)CCC1(C)COCOC1.
What is the InChIKey of methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one?
The InChIKey is BTMJUUGRAQFLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3.2CH4/c1-8(10)3-4-9(2)5-11-7-12-6-9;;/h3-7H2,1-2H3;2*1H4.
What are the key properties of methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one?
methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one has a molecular weight of 204.31 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-(5-methyl-1,3-dioxan-5-yl)butan-2-one is sourced from PubChem (CID 157457109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).