C54H65N3O — CID 157457618
3-[2-(3,5-dipropylphenyl)ethyl]benzaldehyde;2-[[3-[2-(3,5-dipropylphenyl)ethyl]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole;1H-pyrrole (PubChem CID 157457618) has the molecular formula C54H65N3O and a molecular weight of 772.13 g/mol. Its IUPAC name is 3-[2-(3,5-dipropylphenyl)ethyl]benzaldehyde;2-[[3-[2-(3,5-dipropylphenyl)ethyl]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole;1H-pyrrole.
| Compound Name | 3-[2-(3,5-dipropylphenyl)ethyl]benzaldehyde;2-[[3-[2-(3,5-dipropylphenyl)ethyl]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole;1H-pyrrole |
|---|---|
| PubChem CID | 157457618 |
| Molecular Formula | C54H65N3O |
| Molecular Weight | 772.13 g/mol |
| Exact Mass | 771.51 |
| IUPAC Name | 3-[2-(3,5-dipropylphenyl)ethyl]benzaldehyde;2-[[3-[2-(3,5-dipropylphenyl)ethyl]phenyl]-(1H-pyrrol-2-yl)methyl]-1H-pyrrole;1H-pyrrole |
| SMILES | CCCc1cc(CCC)cc(CCc2cccc(C(c3ccc[nH]3)c3ccc[nH]3)c2)c1.CCCc1cc(CCC)cc(CCc2cccc(C=O)c2)c1.c1cc[nH]c1 |
| InChI | InChI=1S/C29H34N2.C21H26O.C4H5N/c1-3-8-23-18-24(9-4-2)20-25(19-23)15-14-22-10-5-11-26(21-22)29(27-12-6-16-30-27)28-13-7-17-31-28;1-3-6-18-13-19(7-4-2)15-20(14-18)11-10-17-8-5-9-21(12-17)16-22;1-2-4-5-3-1/h5-7,10-13,16-21,29-31H,3-4,8-9,14-15H2,1-2H3;5,8-9,12-16H,3-4,6-7,10-11H2,1-2H3;1-5H |
| InChIKey | BTNWWBRBEFBDOG-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.13 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|