C9H15N3 — CID 157457635
1,3-bis(prop-2-enyl)-2,4-dihydro-1,3,5-triazine (PubChem CID 157457635) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-2,4-dihydro-1,3,5-triazine.
| Compound Name | 1,3-bis(prop-2-enyl)-2,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 157457635 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-2,4-dihydro-1,3,5-triazine |
| SMILES | C=CCN1C=NCN(CC=C)C1 |
| InChI | InChI=1S/C9H15N3/c1-3-5-11-7-10-8-12(9-11)6-4-2/h3-4,7H,1-2,5-6,8-9H2 |
| InChIKey | BTNYDFDRFNXTMJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|