C25H24F6O4S — CID 157458341
2-[2-[5-[3,4-bis(hydroxymethyl)phenyl]-4-methoxythiophen-2-yl]-6-ethylphenyl]-1,1,1,4,4,4-hexafluorobutan-2-ol (PubChem CID 157458341) has the molecular formula C25H24F6O4S and a molecular weight of 534.52 g/mol. Its IUPAC name is 2-[2-[5-[3,4-bis(hydroxymethyl)phenyl]-4-methoxythiophen-2-yl]-6-ethylphenyl]-1,1,1,4,4,4-hexafluorobutan-2-ol.
| Compound Name | 2-[2-[5-[3,4-bis(hydroxymethyl)phenyl]-4-methoxythiophen-2-yl]-6-ethylphenyl]-1,1,1,4,4,4-hexafluorobutan-2-ol |
|---|---|
| PubChem CID | 157458341 |
| Molecular Formula | C25H24F6O4S |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-[2-[5-[3,4-bis(hydroxymethyl)phenyl]-4-methoxythiophen-2-yl]-6-ethylphenyl]-1,1,1,4,4,4-hexafluorobutan-2-ol |
| SMILES | CCc1cccc(-c2cc(OC)c(-c3ccc(CO)c(CO)c3)s2)c1C(O)(CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H24F6O4S/c1-3-14-5-4-6-18(21(14)23(34,25(29,30)31)13-24(26,27)28)20-10-19(35-2)22(36-20)15-7-8-16(11-32)17(9-15)12-33/h4-10,32-34H,3,11-13H2,1-2H3 |
| InChIKey | ZFOZCUYMOUZPHF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |