About 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline
3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline (PubChem CID 157458415) has the molecular formula C34H29N3O
and a molecular weight of 495.63 g/mol. Its IUPAC name is 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline.
Molecular Properties
| Compound Name | 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline |
| PubChem CID | 157458415 |
| Molecular Formula | C34H29N3O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline |
| SMILES | Cc1ccc(-c2ccccc2)cc1N.Cc1ccc(-c2ccccc2)cc1NC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C21H16N2O.C13H13N/c1-15-10-11-18(17-7-3-2-4-8-17)13-20(15)23-21(24)19-9-5-6-16(12-19)14-22;1-10-7-8-12(9-13(10)14)11-5-3-2-4-6-11/h2-13H,1H3,(H,23,24);2-9H,14H2,1H3 |
| InChIKey | BTQFDSZYQXWRKR-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline?
The IUPAC name of 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline (CID 157458415) is 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline.
What is the SMILES notation for 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline?
The canonical SMILES for 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline is Cc1ccc(-c2ccccc2)cc1N.Cc1ccc(-c2ccccc2)cc1NC(=O)c1cccc(C#N)c1.
What is the InChIKey of 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline?
The InChIKey is BTQFDSZYQXWRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O.C13H13N/c1-15-10-11-18(17-7-3-2-4-8-17)13-20(15)23-21(24)19-9-5-6-16(12-19)14-22;1-10-7-8-12(9-13(10)14)11-5-3-2-4-6-11/h2-13H,1H3,(H,23,24);2-9H,14H2,1H3.
What are the key properties of 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline?
3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline has a molecular weight of 495.63 g/mol, XLogP of 8.03, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-(2-methyl-5-phenylphenyl)benzamide;2-methyl-5-phenylaniline is sourced from PubChem (CID 157458415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).