About 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane
1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane (PubChem CID 157459974) has the molecular formula C16H28N2OSi
and a molecular weight of 292.50 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane |
| PubChem CID | 157459974 |
| Molecular Formula | C16H28N2OSi |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane |
| SMILES | CC(C)[SiH](C(C)C)C(C)C.Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H22Si.C7H6N2O/c1-7(2)10(8(3)4)9(5)6;10-6-3-5-1-2-8-7(5)9-4-6/h7-10H,1-6H3;1-4,10H,(H,8,9) |
| InChIKey | BTUOZQNURCZABK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane?
The IUPAC name of 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane (CID 157459974) is 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane.
What is the SMILES notation for 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane?
The canonical SMILES for 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane is CC(C)[SiH](C(C)C)C(C)C.Oc1cnc2[nH]ccc2c1.
What is the InChIKey of 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane?
The InChIKey is BTUOZQNURCZABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22Si.C7H6N2O/c1-7(2)10(8(3)4)9(5)6;10-6-3-5-1-2-8-7(5)9-4-6/h7-10H,1-6H3;1-4,10H,(H,8,9).
What are the key properties of 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane?
1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane has a molecular weight of 292.50 g/mol, XLogP of 4.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-b]pyridin-5-ol;tri(propan-2-yl)silane is sourced from PubChem (CID 157459974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).