About (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine
(5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 15746070) has the molecular formula C6H5ClN4S
and a molecular weight of 200.65 g/mol. Its IUPAC name is (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine |
| PubChem CID | 15746070 |
| Molecular Formula | C6H5ClN4S |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1ncnc2scc(Cl)c12 |
| InChI | InChI=1S/C6H5ClN4S/c7-3-1-12-6-4(3)5(11-8)9-2-10-6/h1-2H,8H2,(H,9,10,11) |
| InChIKey | FLUHBQFCPGOGFJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine?
The IUPAC name of (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine (CID 15746070) is (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine.
What is the SMILES notation for (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine?
The canonical SMILES for (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine is NNc1ncnc2scc(Cl)c12.
What is the InChIKey of (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine?
The InChIKey is FLUHBQFCPGOGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN4S/c7-3-1-12-6-4(3)5(11-8)9-2-10-6/h1-2H,8H2,(H,9,10,11).
What are the key properties of (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine?
(5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine has a molecular weight of 200.65 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorothieno[2,3-d]pyrimidin-4-yl)hydrazine is sourced from PubChem (CID 15746070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).