C24H21F3N4O2S — CID 157460725
N-[2-(1-benzylimidazol-4-yl)-4-ethylsulfonylphenyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 157460725) has the molecular formula C24H21F3N4O2S and a molecular weight of 486.52 g/mol. Its IUPAC name is N-[2-(1-benzylimidazol-4-yl)-4-ethylsulfonylphenyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[2-(1-benzylimidazol-4-yl)-4-ethylsulfonylphenyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 157460725 |
| Molecular Formula | C24H21F3N4O2S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-[2-(1-benzylimidazol-4-yl)-4-ethylsulfonylphenyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCS(=O)(=O)c1ccc(Nc2ccc(C(F)(F)F)cn2)c(-c2cn(Cc3ccccc3)cn2)c1 |
| InChI | InChI=1S/C24H21F3N4O2S/c1-2-34(32,33)19-9-10-21(30-23-11-8-18(13-28-23)24(25,26)27)20(12-19)22-15-31(16-29-22)14-17-6-4-3-5-7-17/h3-13,15-16H,2,14H2,1H3,(H,28,30) |
| InChIKey | BTWUFFIMGNGMPH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |