About silane;trichloromethylsilane
silane;trichloromethylsilane (PubChem CID 157461441) has the molecular formula CH7Cl3Si2
and a molecular weight of 181.60 g/mol. Its IUPAC name is silane;trichloromethylsilane.
Molecular Properties
| Compound Name | silane;trichloromethylsilane |
| PubChem CID | 157461441 |
| Molecular Formula | CH7Cl3Si2 |
| Molecular Weight | 181.60 g/mol |
| Exact Mass | 179.92 |
| IUPAC Name | silane;trichloromethylsilane |
| SMILES | [SiH3]C(Cl)(Cl)Cl.[SiH4] |
| InChI | InChI=1S/CH3Cl3Si.H4Si/c2-1(3,4)5;/h5H3;1H4 |
| InChIKey | BTYYQAZHNAEFSX-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.60 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silane;trichloromethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;trichloromethylsilane?
The IUPAC name of silane;trichloromethylsilane (CID 157461441) is silane;trichloromethylsilane.
What is the SMILES notation for silane;trichloromethylsilane?
The canonical SMILES for silane;trichloromethylsilane is [SiH3]C(Cl)(Cl)Cl.[SiH4].
What is the InChIKey of silane;trichloromethylsilane?
The InChIKey is BTYYQAZHNAEFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3Cl3Si.H4Si/c2-1(3,4)5;/h5H3;1H4.
What are the key properties of silane;trichloromethylsilane?
silane;trichloromethylsilane has a molecular weight of 181.60 g/mol, XLogP of -0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for silane;trichloromethylsilane is sourced from PubChem (CID 157461441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).