C36H36F2N4O4 — CID 157462780
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 157462780) has the molecular formula C36H36F2N4O4 and a molecular weight of 626.70 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 157462780 |
| Molecular Formula | C36H36F2N4O4 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[4-[(3S)-1,3,5,5-tetramethyl-2-oxopyrrolidin-3-yl]phenyl]methyl]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cccc4F)nc(Cc4ccc([C@]5(C)CC(C)(C)N(C)C5=O)cc4)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C36H36F2N4O4/c1-35(2)20-36(3,34(44)41(35)4)23-13-10-21(11-14-23)16-27-31-28(40-32(39-27)30-25(37)8-7-9-26(30)38)19-42(33(31)43)18-22-12-15-24(45-5)17-29(22)46-6/h7-15,17H,16,18-20H2,1-6H3/t36-/m0/s1 |
| InChIKey | KLNCIZFNWPPEGT-BHVANESWSA-N |
| XLogP | 6.08 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |