C12H12ClN5O — CID 157463237
6-chloro-N-methyl-4-[(3-methyl-2-pyridinyl)amino]pyridazine-3-carboxamide (PubChem CID 157463237) has the molecular formula C12H12ClN5O and a molecular weight of 277.72 g/mol. Its IUPAC name is 6-chloro-N-methyl-4-[(3-methyl-2-pyridinyl)amino]pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-methyl-4-[(3-methyl-2-pyridinyl)amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 157463237 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-chloro-N-methyl-4-[(3-methyl-2-pyridinyl)amino]pyridazine-3-carboxamide |
| SMILES | CNC(=O)c1nnc(Cl)cc1Nc1ncccc1C |
| InChI | InChI=1S/C12H12ClN5O/c1-7-4-3-5-15-11(7)16-8-6-9(13)17-18-10(8)12(19)14-2/h3-6H,1-2H3,(H,14,19)(H,15,16,17) |
| InChIKey | REBVIRGXYPWDJJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |