About 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline
1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline (PubChem CID 157464341) has the molecular formula C25H35BrN2O4
and a molecular weight of 507.47 g/mol. Its IUPAC name is 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline.
Molecular Properties
| Compound Name | 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline |
| PubChem CID | 157464341 |
| Molecular Formula | C25H35BrN2O4 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline |
| SMILES | CC(C)CCON=O.CC1(Oc2ccc(Br)cc2)CC1.CC1(Oc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C10H11BrO.C10H13NO.C5H11NO2/c2*1-10(6-7-10)12-9-4-2-8(11)3-5-9;1-5(2)3-4-8-6-7/h2-5H,6-7H2,1H3;2-5H,6-7,11H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | BUHIOEBCFLBYLC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline?
The IUPAC name of 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline (CID 157464341) is 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline.
What is the SMILES notation for 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline?
The canonical SMILES for 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline is CC(C)CCON=O.CC1(Oc2ccc(Br)cc2)CC1.CC1(Oc2ccc(N)cc2)CC1.
What is the InChIKey of 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline?
The InChIKey is BUHIOEBCFLBYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO.C10H13NO.C5H11NO2/c2*1-10(6-7-10)12-9-4-2-8(11)3-5-9;1-5(2)3-4-8-6-7/h2-5H,6-7H2,1H3;2-5H,6-7,11H2,1H3;5H,3-4H2,1-2H3.
What are the key properties of 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline?
1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline has a molecular weight of 507.47 g/mol, XLogP of 7.31, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(1-methylcyclopropyl)oxybenzene;3-methylbutyl nitrite;4-(1-methylcyclopropyl)oxyaniline is sourced from PubChem (CID 157464341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).