C20H22N2O — CID 157464507
3,7,7-trimethyl-4-phenyl-4,6,8,9-tetrahydro-2H-benzo[f]indazol-5-one (PubChem CID 157464507) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 3,7,7-trimethyl-4-phenyl-4,6,8,9-tetrahydro-2H-benzo[f]indazol-5-one.
| Compound Name | 3,7,7-trimethyl-4-phenyl-4,6,8,9-tetrahydro-2H-benzo[f]indazol-5-one |
|---|---|
| PubChem CID | 157464507 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3,7,7-trimethyl-4-phenyl-4,6,8,9-tetrahydro-2H-benzo[f]indazol-5-one |
| SMILES | Cc1[nH]nc2c1C(c1ccccc1)C1=C(C2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C20H22N2O/c1-12-17-15(22-21-12)9-14-10-20(2,3)11-16(23)18(14)19(17)13-7-5-4-6-8-13/h4-8,19H,9-11H2,1-3H3,(H,21,22) |
| InChIKey | BZOJXDDRQXAVCL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |