C16H15F3N2O2S2 — CID 157465767
1-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7,7,7-trifluoroheptane-1,6-dione (PubChem CID 157465767) has the molecular formula C16H15F3N2O2S2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7,7,7-trifluoroheptane-1,6-dione.
| Compound Name | 1-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7,7,7-trifluoroheptane-1,6-dione |
|---|---|
| PubChem CID | 157465767 |
| Molecular Formula | C16H15F3N2O2S2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7,7,7-trifluoroheptane-1,6-dione |
| SMILES | O=C(CCCCC(=O)C(F)(F)F)c1nc(-c2nccs2)sc1C1CC1 |
| InChI | InChI=1S/C16H15F3N2O2S2/c17-16(18,19)11(23)4-2-1-3-10(22)12-13(9-5-6-9)25-15(21-12)14-20-7-8-24-14/h7-9H,1-6H2 |
| InChIKey | WICJXVLFLWOPSB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|