About 3-bromo-6,7-dihydro-5H-benzo[c]fluorene
3-bromo-6,7-dihydro-5H-benzo[c]fluorene (PubChem CID 157467140) has the molecular formula C17H13Br
and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-bromo-6,7-dihydro-5H-benzo[c]fluorene.
Molecular Properties
| Compound Name | 3-bromo-6,7-dihydro-5H-benzo[c]fluorene |
| PubChem CID | 157467140 |
| Molecular Formula | C17H13Br |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-bromo-6,7-dihydro-5H-benzo[c]fluorene |
| SMILES | Brc1ccc2c(c1)CCC1=C2c2ccccc2C1 |
| InChI | InChI=1S/C17H13Br/c18-14-7-8-16-12(10-14)5-6-13-9-11-3-1-2-4-15(11)17(13)16/h1-4,7-8,10H,5-6,9H2 |
| InChIKey | JGKFXZAHZJMQAX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-bromo-6,7-dihydro-5H-benzo[c]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6,7-dihydro-5H-benzo[c]fluorene?
The IUPAC name of 3-bromo-6,7-dihydro-5H-benzo[c]fluorene (CID 157467140) is 3-bromo-6,7-dihydro-5H-benzo[c]fluorene.
What is the SMILES notation for 3-bromo-6,7-dihydro-5H-benzo[c]fluorene?
The canonical SMILES for 3-bromo-6,7-dihydro-5H-benzo[c]fluorene is Brc1ccc2c(c1)CCC1=C2c2ccccc2C1.
What is the InChIKey of 3-bromo-6,7-dihydro-5H-benzo[c]fluorene?
The InChIKey is JGKFXZAHZJMQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Br/c18-14-7-8-16-12(10-14)5-6-13-9-11-3-1-2-4-15(11)17(13)16/h1-4,7-8,10H,5-6,9H2.
What are the key properties of 3-bromo-6,7-dihydro-5H-benzo[c]fluorene?
3-bromo-6,7-dihydro-5H-benzo[c]fluorene has a molecular weight of 297.19 g/mol, XLogP of 4.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6,7-dihydro-5H-benzo[c]fluorene is sourced from PubChem (CID 157467140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).