C28H37N5O6S — CID 157467389
2-[3-[2-(dimethylamino)ethoxy]anilino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide;methanesulfonic acid (PubChem CID 157467389) has the molecular formula C28H37N5O6S and a molecular weight of 571.70 g/mol. Its IUPAC name is 2-[3-[2-(dimethylamino)ethoxy]anilino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide;methanesulfonic acid.
| Compound Name | 2-[3-[2-(dimethylamino)ethoxy]anilino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide;methanesulfonic acid |
|---|---|
| PubChem CID | 157467389 |
| Molecular Formula | C28H37N5O6S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 2-[3-[2-(dimethylamino)ethoxy]anilino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1nn(-c2ccc(C(N)=O)c(Nc3cccc(OCCN(C)C)c3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C27H33N5O3.CH4O3S/c1-17-25-23(15-27(2,3)16-24(25)33)32(30-17)19-9-10-21(26(28)34)22(14-19)29-18-7-6-8-20(13-18)35-12-11-31(4)5;1-5(2,3)4/h6-10,13-14,29H,11-12,15-16H2,1-5H3,(H2,28,34);1H3,(H,2,3,4) |
| InChIKey | QIJHWQLAYHUHKR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|