C35H38N8O3 — CID 157468041
(12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]methyl]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione (PubChem CID 157468041) has the molecular formula C35H38N8O3 and a molecular weight of 618.74 g/mol. Its IUPAC name is (12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]methyl]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione.
| Compound Name | (12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]methyl]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
|---|---|
| PubChem CID | 157468041 |
| Molecular Formula | C35H38N8O3 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | (12Z)-5-[[1-(1-propan-2-ylpiperidin-4-yl)indol-5-yl]methyl]-20-oxa-2,4,6,10,17,24-hexazapentacyclo[15.6.2.02,10.03,8.021,25]pentacosa-1(24),3,5,7,12,21(25),22-heptaene-9,18-dione |
| SMILES | CC(C)N1CCC(n2ccc3cc(Cc4ncc5c(=O)n6n(c5n4)-c4ccc5c(n4)N(CCC/C=C\C6)C(=O)CO5)ccc32)CC1 |
| InChI | InChI=1S/C35H38N8O3/c1-23(2)39-16-12-26(13-17-39)40-18-11-25-19-24(7-8-28(25)40)20-30-36-21-27-33(37-30)43-31-10-9-29-34(38-31)41(32(44)22-46-29)14-5-3-4-6-15-42(43)35(27)45/h4,6-11,18-19,21,23,26H,3,5,12-17,20,22H2,1-2H3/b6-4- |
| InChIKey | BURXZRXMIDPUQC-XQRVVYSFSA-N |
| XLogP | 4.64 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|