C26H25NO7S — CID 157468124
[[6-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-pyridinyl]-(2-methoxyphenyl)methyl] methanesulfonate (PubChem CID 157468124) has the molecular formula C26H25NO7S and a molecular weight of 495.55 g/mol. Its IUPAC name is [[6-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-pyridinyl]-(2-methoxyphenyl)methyl] methanesulfonate.
| Compound Name | [[6-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-pyridinyl]-(2-methoxyphenyl)methyl] methanesulfonate |
|---|---|
| PubChem CID | 157468124 |
| Molecular Formula | C26H25NO7S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | [[6-[2-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-oxoethyl]-3-pyridinyl]-(2-methoxyphenyl)methyl] methanesulfonate |
| SMILES | COc1ccccc1C(OS(C)(=O)=O)c1ccc(CC(=O)C2(c3ccc4c(c3)OCO4)CC2)nc1 |
| InChI | InChI=1S/C26H25NO7S/c1-31-21-6-4-3-5-20(21)25(34-35(2,29)30)17-7-9-19(27-15-17)14-24(28)26(11-12-26)18-8-10-22-23(13-18)33-16-32-22/h3-10,13,15,25H,11-12,14,16H2,1-2H3 |
| InChIKey | AUODMKWFISGXLQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|