About 2-tert-butylfuran;3-tert-butyl-1,2-oxazole
2-tert-butylfuran;3-tert-butyl-1,2-oxazole (PubChem CID 157469679) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-tert-butylfuran;3-tert-butyl-1,2-oxazole.
Molecular Properties
| Compound Name | 2-tert-butylfuran;3-tert-butyl-1,2-oxazole |
| PubChem CID | 157469679 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-tert-butylfuran;3-tert-butyl-1,2-oxazole |
| SMILES | CC(C)(C)c1ccco1.CC(C)(C)c1ccon1 |
| InChI | InChI=1S/C8H12O.C7H11NO/c1-8(2,3)7-5-4-6-9-7;1-7(2,3)6-4-5-9-8-6/h4-6H,1-3H3;4-5H,1-3H3 |
| InChIKey | BUWPHMCHQQVNKV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butylfuran;3-tert-butyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylfuran;3-tert-butyl-1,2-oxazole?
The IUPAC name of 2-tert-butylfuran;3-tert-butyl-1,2-oxazole (CID 157469679) is 2-tert-butylfuran;3-tert-butyl-1,2-oxazole.
What is the SMILES notation for 2-tert-butylfuran;3-tert-butyl-1,2-oxazole?
The canonical SMILES for 2-tert-butylfuran;3-tert-butyl-1,2-oxazole is CC(C)(C)c1ccco1.CC(C)(C)c1ccon1.
What is the InChIKey of 2-tert-butylfuran;3-tert-butyl-1,2-oxazole?
The InChIKey is BUWPHMCHQQVNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.C7H11NO/c1-8(2,3)7-5-4-6-9-7;1-7(2,3)6-4-5-9-8-6/h4-6H,1-3H3;4-5H,1-3H3.
What are the key properties of 2-tert-butylfuran;3-tert-butyl-1,2-oxazole?
2-tert-butylfuran;3-tert-butyl-1,2-oxazole has a molecular weight of 249.35 g/mol, XLogP of 4.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylfuran;3-tert-butyl-1,2-oxazole is sourced from PubChem (CID 157469679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).