C22H18N4O7 — CID 157470705
2-(carboxymethoxy)-4-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]benzoic acid (PubChem CID 157470705) has the molecular formula C22H18N4O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is 2-(carboxymethoxy)-4-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]benzoic acid.
| Compound Name | 2-(carboxymethoxy)-4-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 157470705 |
| Molecular Formula | C22H18N4O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-(carboxymethoxy)-4-[3-ethoxy-4-(6-oxo-1,7-dihydropurin-2-yl)phenyl]benzoic acid |
| SMILES | CCOc1cc(-c2ccc(C(=O)O)c(OCC(=O)O)c2)ccc1-c1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C22H18N4O7/c1-2-32-15-7-11(12-4-6-14(22(30)31)16(8-12)33-9-17(27)28)3-5-13(15)19-25-20-18(21(29)26-19)23-10-24-20/h3-8,10H,2,9H2,1H3,(H,27,28)(H,30,31)(H2,23,24,25,26,29) |
| InChIKey | MLZDOQVEQOIUJW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |