About dichloromethane;pyridine-2,5-dione
dichloromethane;pyridine-2,5-dione (PubChem CID 157470922) has the molecular formula C6H5Cl2NO2
and a molecular weight of 194.02 g/mol. Its IUPAC name is dichloromethane;pyridine-2,5-dione.
Molecular Properties
| Compound Name | dichloromethane;pyridine-2,5-dione |
| PubChem CID | 157470922 |
| Molecular Formula | C6H5Cl2NO2 |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | dichloromethane;pyridine-2,5-dione |
| SMILES | ClCCl.O=C1C=CC(=O)N=C1 |
| InChI | InChI=1S/C5H3NO2.CH2Cl2/c7-4-1-2-5(8)6-3-4;2-1-3/h1-3H;1H2 |
| InChIKey | BVAILKQFONSFIS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;pyridine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;pyridine-2,5-dione?
The IUPAC name of dichloromethane;pyridine-2,5-dione (CID 157470922) is dichloromethane;pyridine-2,5-dione.
What is the SMILES notation for dichloromethane;pyridine-2,5-dione?
The canonical SMILES for dichloromethane;pyridine-2,5-dione is ClCCl.O=C1C=CC(=O)N=C1.
What is the InChIKey of dichloromethane;pyridine-2,5-dione?
The InChIKey is BVAILKQFONSFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO2.CH2Cl2/c7-4-1-2-5(8)6-3-4;2-1-3/h1-3H;1H2.
What are the key properties of dichloromethane;pyridine-2,5-dione?
dichloromethane;pyridine-2,5-dione has a molecular weight of 194.02 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;pyridine-2,5-dione is sourced from PubChem (CID 157470922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).