About ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane
ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane (PubChem CID 157472264) has the molecular formula C21H36O3
and a molecular weight of 336.52 g/mol. Its IUPAC name is ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane.
Molecular Properties
| Compound Name | ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane |
| PubChem CID | 157472264 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane |
| SMILES | CCCCCCC.CCOC(=O)C1C(C)=CC(=O)CC12CCCC2 |
| InChI | InChI=1S/C14H20O3.C7H16/c1-3-17-13(16)12-10(2)8-11(15)9-14(12)6-4-5-7-14;1-3-5-7-6-4-2/h8,12H,3-7,9H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | BVEIVEMTQXPQSI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane?
The IUPAC name of ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane (CID 157472264) is ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane.
What is the SMILES notation for ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane?
The canonical SMILES for ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane is CCCCCCC.CCOC(=O)C1C(C)=CC(=O)CC12CCCC2.
What is the InChIKey of ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane?
The InChIKey is BVEIVEMTQXPQSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3.C7H16/c1-3-17-13(16)12-10(2)8-11(15)9-14(12)6-4-5-7-14;1-3-5-7-6-4-2/h8,12H,3-7,9H2,1-2H3;3-7H2,1-2H3.
What are the key properties of ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane?
ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane has a molecular weight of 336.52 g/mol, XLogP of 5.62, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 9-methyl-7-oxospiro[4.5]dec-8-ene-10-carboxylate;heptane is sourced from PubChem (CID 157472264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).