C26H33N3O5Si — CID 15747245
1-[(2R,4S,5R)-5-(aminooxymethyl)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 15747245) has the molecular formula C26H33N3O5Si and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(aminooxymethyl)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-(aminooxymethyl)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15747245 |
| Molecular Formula | C26H33N3O5Si |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(aminooxymethyl)-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](CON)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H33N3O5Si/c1-18-16-29(25(31)28-24(18)30)23-15-21(22(33-23)17-32-27)34-35(26(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,16,21-23H,15,17,27H2,1-4H3,(H,28,30,31)/t21-,22+,23+/m0/s1 |
| InChIKey | RTJXQKPNRCJIFF-YTFSRNRJSA-N |
| XLogP | 1.97 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|