About tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate
tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate (PubChem CID 157472754) has the molecular formula C24H30N2O8S
and a molecular weight of 506.58 g/mol. Its IUPAC name is tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate.
Molecular Properties
| Compound Name | tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate |
| PubChem CID | 157472754 |
| Molecular Formula | C24H30N2O8S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate |
| SMILES | CC(C[C@@H](C)Cc1ccc(CS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30N2O8S/c1-16(12-17(2)23(27)34-24(3,4)5)13-18-6-7-19(22(14-18)26(30)31)15-35(32,33)21-10-8-20(9-11-21)25(28)29/h6-11,14,16-17H,12-13,15H2,1-5H3/t16-,17?/m1/s1 |
| InChIKey | BVFVFNFGPLCVOY-TZHYSIJRSA-N |
| XLogP | 5.02 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate?
The IUPAC name of tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate (CID 157472754) is tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate.
What is the SMILES notation for tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate?
The canonical SMILES for tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate is CC(C[C@@H](C)Cc1ccc(CS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate?
The InChIKey is BVFVFNFGPLCVOY-TZHYSIJRSA-N. The full InChI is InChI=1S/C24H30N2O8S/c1-16(12-17(2)23(27)34-24(3,4)5)13-18-6-7-19(22(14-18)26(30)31)15-35(32,33)21-10-8-20(9-11-21)25(28)29/h6-11,14,16-17H,12-13,15H2,1-5H3/t16-,17?/m1/s1.
What are the key properties of tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate?
tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate has a molecular weight of 506.58 g/mol, XLogP of 5.02, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R)-2,4-dimethyl-5-[3-nitro-4-[(4-nitrophenyl)sulfonylmethyl]phenyl]pentanoate is sourced from PubChem (CID 157472754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).