About tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate
tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate (PubChem CID 157473394) has the molecular formula C21H46N4O12
and a molecular weight of 546.62 g/mol. Its IUPAC name is tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate.
Molecular Properties
| Compound Name | tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate |
| PubChem CID | 157473394 |
| Molecular Formula | C21H46N4O12 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)COC.CNC(=O)OCCOC.CNC(=O)OCCOC.CNC(=O)OCCOC |
| InChI | InChI=1S/C6H13NO3.3C5H11NO3/c1-5(4-9-3)10-6(8)7-2;3*1-6-5(7)9-4-3-8-2/h5H,4H2,1-3H3,(H,7,8);3*3-4H2,1-2H3,(H,6,7) |
| InChIKey | BVHNUGIVTKYAQM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 190.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate?
The IUPAC name of tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate (CID 157473394) is tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate.
What is the SMILES notation for tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate?
The canonical SMILES for tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate is CNC(=O)OC(C)COC.CNC(=O)OCCOC.CNC(=O)OCCOC.CNC(=O)OCCOC.
What is the InChIKey of tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate?
The InChIKey is BVHNUGIVTKYAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3.3C5H11NO3/c1-5(4-9-3)10-6(8)7-2;3*1-6-5(7)9-4-3-8-2/h5H,4H2,1-3H3,(H,7,8);3*3-4H2,1-2H3,(H,6,7).
What are the key properties of tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate?
tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate has a molecular weight of 546.62 g/mol, XLogP of 0.34, 12 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate is sourced from PubChem (CID 157473394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).