C21H46N4O12 — CID 157473394
tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate (PubChem CID 157473394) has the molecular formula C21H46N4O12 and a molecular weight of 546.62 g/mol. Its IUPAC name is tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate.
| Compound Name | tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate |
|---|---|
| PubChem CID | 157473394 |
| Molecular Formula | C21H46N4O12 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | tris(2-methoxyethyl N-methylcarbamate);1-methoxypropan-2-yl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)COC.CNC(=O)OCCOC.CNC(=O)OCCOC.CNC(=O)OCCOC |
| InChI | InChI=1S/C6H13NO3.3C5H11NO3/c1-5(4-9-3)10-6(8)7-2;3*1-6-5(7)9-4-3-8-2/h5H,4H2,1-3H3,(H,7,8);3*3-4H2,1-2H3,(H,6,7) |
| InChIKey | BVHNUGIVTKYAQM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 190.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|