C11H20FNO2 — CID 157473658
(3aS,6S,6aS)-4-tert-butyl-6-fluoro-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-3-one;methane (PubChem CID 157473658) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is (3aS,6S,6aS)-4-tert-butyl-6-fluoro-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-3-one;methane.
| Compound Name | (3aS,6S,6aS)-4-tert-butyl-6-fluoro-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-3-one;methane |
|---|---|
| PubChem CID | 157473658 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3aS,6S,6aS)-4-tert-butyl-6-fluoro-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-3-one;methane |
| SMILES | C.CC(C)(C)N1C[C@H](F)[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C10H16FNO2.CH4/c1-10(2,3)12-4-6(11)9-8(12)7(13)5-14-9;/h6,8-9H,4-5H2,1-3H3;1H4/t6-,8+,9+;/m0./s1 |
| InChIKey | BVIFAXZAHDFSLB-IVWNVDGJSA-N |
| XLogP | 1.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |