C24H18N4O4 — CID 157474149
azane;dodeca-2,4,6,8,10-pentaynoic acid;(2Z)-2-(1H-imidazol-2-ylmethylidene)-1-benzofuran-3-one (PubChem CID 157474149) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is azane;dodeca-2,4,6,8,10-pentaynoic acid;(2Z)-2-(1H-imidazol-2-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | azane;dodeca-2,4,6,8,10-pentaynoic acid;(2Z)-2-(1H-imidazol-2-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 157474149 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | azane;dodeca-2,4,6,8,10-pentaynoic acid;(2Z)-2-(1H-imidazol-2-ylmethylidene)-1-benzofuran-3-one |
| SMILES | CC#CC#CC#CC#CC#CC(=O)O.N.N.O=C1/C(=C/c2ncc[nH]2)Oc2ccccc21 |
| InChI | InChI=1S/C12H8N2O2.C12H4O2.2H3N/c15-12-8-3-1-2-4-9(8)16-10(12)7-11-13-5-6-14-11;1-2-3-4-5-6-7-8-9-10-11-12(13)14;;/h1-7H,(H,13,14);1H3,(H,13,14);2*1H3/b10-7-;;; |
| InChIKey | RRMHFZNHPPCBCE-SULXSYCDSA-N |
| XLogP | 2.46 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|