C17H16N4O2S — CID 157474452
3-(5-propan-2-yltetrazol-1-yl)-5-(4-sulfanylphenyl)benzoic acid (PubChem CID 157474452) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-(5-propan-2-yltetrazol-1-yl)-5-(4-sulfanylphenyl)benzoic acid.
| Compound Name | 3-(5-propan-2-yltetrazol-1-yl)-5-(4-sulfanylphenyl)benzoic acid |
|---|---|
| PubChem CID | 157474452 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(5-propan-2-yltetrazol-1-yl)-5-(4-sulfanylphenyl)benzoic acid |
| SMILES | CC(C)c1nnnn1-c1cc(C(=O)O)cc(-c2ccc(S)cc2)c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-10(2)16-18-19-20-21(16)14-8-12(7-13(9-14)17(22)23)11-3-5-15(24)6-4-11/h3-10,24H,1-2H3,(H,22,23) |
| InChIKey | QUXGFRQONRPKSG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|