C27H36N4O7 — CID 157474566
N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-(5-methyl-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide;(3S)-3-formyloxy-3-hydroxypropanoic acid (PubChem CID 157474566) has the molecular formula C27H36N4O7 and a molecular weight of 528.61 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-(5-methyl-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide;(3S)-3-formyloxy-3-hydroxypropanoic acid.
| Compound Name | N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-(5-methyl-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide;(3S)-3-formyloxy-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 157474566 |
| Molecular Formula | C27H36N4O7 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-(5-methyl-2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide;(3S)-3-formyloxy-3-hydroxypropanoic acid |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(C)cc32)c1C.O=CO[C@H](O)CC(=O)O |
| InChI | InChI=1S/C23H30N4O2.C4H6O5/c1-6-27(7-2)11-10-24-23(29)21-15(4)20(25-16(21)5)13-18-17-12-14(3)8-9-19(17)26-22(18)28;5-2-9-4(8)1-3(6)7/h8-9,12-13,25H,6-7,10-11H2,1-5H3,(H,24,29)(H,26,28);2,4,8H,1H2,(H,6,7)/b18-13-;/t;4-/m.0/s1 |
| InChIKey | BVKZCGHYDRNGJV-MOAJTROMSA-N |
| XLogP | 2.46 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|