C40H28Br4N4O2 — CID 157474723
benzene-1,2-diamine;1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)quinoxaline (PubChem CID 157474723) has the molecular formula C40H28Br4N4O2 and a molecular weight of 916.31 g/mol. Its IUPAC name is benzene-1,2-diamine;1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)quinoxaline.
| Compound Name | benzene-1,2-diamine;1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)quinoxaline |
|---|---|
| PubChem CID | 157474723 |
| Molecular Formula | C40H28Br4N4O2 |
| Molecular Weight | 916.31 g/mol |
| Exact Mass | 911.89 |
| IUPAC Name | benzene-1,2-diamine;1,2-bis(4-bromophenyl)ethane-1,2-dione;2,3-bis(4-bromophenyl)quinoxaline |
| SMILES | Brc1ccc(-c2nc3ccccc3nc2-c2ccc(Br)cc2)cc1.Nc1ccccc1N.O=C(C(=O)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H12Br2N2.C14H8Br2O2.C6H8N2/c21-15-9-5-13(6-10-15)19-20(14-7-11-16(22)12-8-14)24-18-4-2-1-3-17(18)23-19;15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;7-5-3-1-2-4-6(5)8/h1-12H;1-8H;1-4H,7-8H2 |
| InChIKey | BVLMQKDQEYCODW-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.31 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|