About dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane
dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane (PubChem CID 157474730) has the molecular formula C8H25Cl2NSi3
and a molecular weight of 290.46 g/mol. Its IUPAC name is dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane.
Molecular Properties
| Compound Name | dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane |
| PubChem CID | 157474730 |
| Molecular Formula | C8H25Cl2NSi3 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane |
| SMILES | C[Si](C)(C)N[Si](C)(C)C.C[Si](C)(Cl)Cl |
| InChI | InChI=1S/C6H19NSi2.C2H6Cl2Si/c1-8(2,3)7-9(4,5)6;1-5(2,3)4/h7H,1-6H3;1-2H3 |
| InChIKey | BVLMUTOSLXQUDH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
The IUPAC name of dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane (CID 157474730) is dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane.
What is the SMILES notation for dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
The canonical SMILES for dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane is C[Si](C)(C)N[Si](C)(C)C.C[Si](C)(Cl)Cl.
What is the InChIKey of dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
The InChIKey is BVLMUTOSLXQUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19NSi2.C2H6Cl2Si/c1-8(2,3)7-9(4,5)6;1-5(2,3)4/h7H,1-6H3;1-2H3.
What are the key properties of dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane?
dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane has a molecular weight of 290.46 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethyl)silane;[dimethyl-(trimethylsilylamino)silyl]methane is sourced from PubChem (CID 157474730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).