C20H18N4 — CID 157474934
2-[[3-(5-methyl-1H-pyrazol-3-yl)phenyl]methyl]-6-(1H-pyrrol-2-yl)pyridine (PubChem CID 157474934) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[[3-(5-methyl-1H-pyrazol-3-yl)phenyl]methyl]-6-(1H-pyrrol-2-yl)pyridine.
| Compound Name | 2-[[3-(5-methyl-1H-pyrazol-3-yl)phenyl]methyl]-6-(1H-pyrrol-2-yl)pyridine |
|---|---|
| PubChem CID | 157474934 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[[3-(5-methyl-1H-pyrazol-3-yl)phenyl]methyl]-6-(1H-pyrrol-2-yl)pyridine |
| SMILES | Cc1cc(-c2cccc(Cc3cccc(-c4ccc[nH]4)n3)c2)n[nH]1 |
| InChI | InChI=1S/C20H18N4/c1-14-11-20(24-23-14)16-6-2-5-15(12-16)13-17-7-3-8-19(22-17)18-9-4-10-21-18/h2-12,21H,13H2,1H3,(H,23,24) |
| InChIKey | QTWFQDHNRNFQGA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |