C39H70O8P2 — CID 157475143
[2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-diethoxyphosphoryl-4-[ethoxy(methyl)phosphoryl]butanoate (PubChem CID 157475143) has the molecular formula C39H70O8P2 and a molecular weight of 728.93 g/mol. Its IUPAC name is [2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-diethoxyphosphoryl-4-[ethoxy(methyl)phosphoryl]butanoate.
| Compound Name | [2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-diethoxyphosphoryl-4-[ethoxy(methyl)phosphoryl]butanoate |
|---|---|
| PubChem CID | 157475143 |
| Molecular Formula | C39H70O8P2 |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.45 |
| IUPAC Name | [2,5,7-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 4-diethoxyphosphoryl-4-[ethoxy(methyl)phosphoryl]butanoate |
| SMILES | CCOP(C)(=O)C(CCC(=O)Oc1c(C)cc2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2)P(=O)(OCC)OCC |
| InChI | InChI=1S/C39H70O8P2/c1-12-43-48(11,41)37(49(42,44-13-2)45-14-3)24-23-36(40)46-38-32(8)28-35-34(33(38)9)25-27-39(10,47-35)26-17-22-31(7)21-16-20-30(6)19-15-18-29(4)5/h28-31,37H,12-27H2,1-11H3 |
| InChIKey | DEGWQQYIGYBUPM-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|