About uranium diphosphite
uranium diphosphite (PubChem CID 157475299) has the molecular formula O6P2U-6
and a molecular weight of 395.97 g/mol. Its IUPAC name is uranium diphosphite.
Molecular Properties
| Compound Name | uranium diphosphite |
| PubChem CID | 157475299 |
| Molecular Formula | O6P2U-6 |
| Molecular Weight | 395.97 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | uranium diphosphite |
| SMILES | [O-]P([O-])[O-].[O-]P([O-])[O-].[U] |
| InChI | InChI=1S/2O3P.U/c2*1-4(2)3;/q2*-3; |
| InChIKey | YWDHURYMPPHCDV-UHFFFAOYSA-N |
| XLogP | -5.41 |
| TPSA | 138.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.97 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze uranium diphosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of uranium diphosphite?
The IUPAC name of uranium diphosphite (CID 157475299) is uranium diphosphite.
What is the SMILES notation for uranium diphosphite?
The canonical SMILES for uranium diphosphite is [O-]P([O-])[O-].[O-]P([O-])[O-].[U].
What is the InChIKey of uranium diphosphite?
The InChIKey is YWDHURYMPPHCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/2O3P.U/c2*1-4(2)3;/q2*-3;.
What are the key properties of uranium diphosphite?
uranium diphosphite has a molecular weight of 395.97 g/mol, XLogP of -5.41, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for uranium diphosphite is sourced from PubChem (CID 157475299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).