C11H20O2 — CID 15747679
(E)-8-hydroxy-4,8-dimethylnon-3-en-2-one (PubChem CID 15747679) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-8-hydroxy-4,8-dimethylnon-3-en-2-one.
| Compound Name | (E)-8-hydroxy-4,8-dimethylnon-3-en-2-one |
|---|---|
| PubChem CID | 15747679 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E)-8-hydroxy-4,8-dimethylnon-3-en-2-one |
| SMILES | CC(=O)/C=C(\C)CCCC(C)(C)O |
| InChI | InChI=1S/C11H20O2/c1-9(8-10(2)12)6-5-7-11(3,4)13/h8,13H,5-7H2,1-4H3/b9-8+ |
| InChIKey | XYGMRLGRLAPRJJ-CMDGGOBGSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|