C18H25N4O9P — CID 157477127
ethyl 4-[[(2S,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate (PubChem CID 157477127) has the molecular formula C18H25N4O9P and a molecular weight of 472.39 g/mol. Its IUPAC name is ethyl 4-[[(2S,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate.
| Compound Name | ethyl 4-[[(2S,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 157477127 |
| Molecular Formula | C18H25N4O9P |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | ethyl 4-[[(2S,4aR,6R,7R,7aS)-7-azido-6-(2,4-dioxo-1-pyridinyl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)CCO[P@@]1(=O)OC[C@H]2O[C@@H](N3C=CC(=O)CC3=O)[C@](C)(N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C18H25N4O9P/c1-4-27-16(25)11(2)6-8-28-32(26)29-10-13-15(31-32)18(3,20-21-19)17(30-13)22-7-5-12(23)9-14(22)24/h5,7,11,13,15,17H,4,6,8-10H2,1-3H3/t11?,13-,15-,17-,18-,32+/m1/s1 |
| InChIKey | DBXZPZWWFLPSGX-SDBJWNAUSA-N |
| XLogP | 2.22 |
| TPSA | 166.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|