C13H18O6 — CID 15747729
[1-acetyloxy-1,2-dideuterio-2-methyl-3-[(6R)-5-oxo-2H-pyran-6-yl]propyl] acetate (PubChem CID 15747729) has the molecular formula C13H18O6 and a molecular weight of 272.29 g/mol. Its IUPAC name is [1-acetyloxy-1,2-dideuterio-2-methyl-3-[(6R)-5-oxo-2H-pyran-6-yl]propyl] acetate.
| Compound Name | [1-acetyloxy-1,2-dideuterio-2-methyl-3-[(6R)-5-oxo-2H-pyran-6-yl]propyl] acetate |
|---|---|
| PubChem CID | 15747729 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [1-acetyloxy-1,2-dideuterio-2-methyl-3-[(6R)-5-oxo-2H-pyran-6-yl]propyl] acetate |
| SMILES | [2H]C(C)(C[C@H]1OCC=CC1=O)C([2H])(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C13H18O6/c1-8(7-12-11(16)5-4-6-17-12)13(18-9(2)14)19-10(3)15/h4-5,8,12-13H,6-7H2,1-3H3/t8?,12-/m1/s1/i8D,13D |
| InChIKey | KNJBCRCIJVERMU-AYIJEBANSA-N |
| XLogP | 0.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|