C16H28N2O4 — CID 157477560
cis-(3R,5S)-3,5-dimethoxycyclohexan-1-amine;3,5-dimethoxyaniline (PubChem CID 157477560) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is cis-(3R,5S)-3,5-dimethoxycyclohexan-1-amine;3,5-dimethoxyaniline.
| Compound Name | cis-(3R,5S)-3,5-dimethoxycyclohexan-1-amine;3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 157477560 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | cis-(3R,5S)-3,5-dimethoxycyclohexan-1-amine;3,5-dimethoxyaniline |
| SMILES | CO[C@@H]1CC(N)C[C@H](OC)C1.COc1cc(N)cc(OC)c1 |
| InChI | InChI=1S/C8H17NO2.C8H11NO2/c2*1-10-7-3-6(9)4-8(5-7)11-2/h6-8H,3-5,9H2,1-2H3;3-5H,9H2,1-2H3/t6?,7-,8+; |
| InChIKey | BVTUMZKZIXQGGH-OPZYXJLOSA-N |
| XLogP | 1.81 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|