About azane;trichlorophosphane
azane;trichlorophosphane (PubChem CID 157477730) has the molecular formula H3Cl3NP
and a molecular weight of 154.36 g/mol. Its IUPAC name is azane;trichlorophosphane.
Molecular Properties
| Compound Name | azane;trichlorophosphane |
| PubChem CID | 157477730 |
| Molecular Formula | H3Cl3NP |
| Molecular Weight | 154.36 g/mol |
| Exact Mass | 152.91 |
| IUPAC Name | azane;trichlorophosphane |
| SMILES | ClP(Cl)Cl.N |
| InChI | InChI=1S/Cl3P.H3N/c1-4(2)3;/h;1H3 |
| InChIKey | BVUHLWFLCVIBPJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;trichlorophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;trichlorophosphane?
The IUPAC name of azane;trichlorophosphane (CID 157477730) is azane;trichlorophosphane.
What is the SMILES notation for azane;trichlorophosphane?
The canonical SMILES for azane;trichlorophosphane is ClP(Cl)Cl.N.
What is the InChIKey of azane;trichlorophosphane?
The InChIKey is BVUHLWFLCVIBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl3P.H3N/c1-4(2)3;/h;1H3.
What are the key properties of azane;trichlorophosphane?
azane;trichlorophosphane has a molecular weight of 154.36 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;trichlorophosphane is sourced from PubChem (CID 157477730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).