C21H36O2Si — CID 15747888
(3aR,4aR,8aR,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-1,1,3a-trimethyl-3,4a,5,6,8a,8b-hexahydro-2H-cyclopenta[a]inden-4-one (PubChem CID 15747888) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (3aR,4aR,8aR,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-1,1,3a-trimethyl-3,4a,5,6,8a,8b-hexahydro-2H-cyclopenta[a]inden-4-one.
| Compound Name | (3aR,4aR,8aR,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-1,1,3a-trimethyl-3,4a,5,6,8a,8b-hexahydro-2H-cyclopenta[a]inden-4-one |
|---|---|
| PubChem CID | 15747888 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3aR,4aR,8aR,8bS)-8-[tert-butyl(dimethyl)silyl]oxy-1,1,3a-trimethyl-3,4a,5,6,8a,8b-hexahydro-2H-cyclopenta[a]inden-4-one |
| SMILES | CC1(C)CC[C@@]2(C)C(=O)[C@@H]3CCC=C(O[Si](C)(C)C(C)(C)C)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C21H36O2Si/c1-19(2,3)24(7,8)23-15-11-9-10-14-16(15)17-20(4,5)12-13-21(17,6)18(14)22/h11,14,16-17H,9-10,12-13H2,1-8H3/t14-,16-,17+,21-/m1/s1 |
| InChIKey | HABTYYYHBYVOSD-RACNMONISA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|