C33H25N7O2 — CID 157479216
3-amino-N-[(1R)-1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-6-(3H-pyrrol-5-yl)pyrazine-2-carboxamide (PubChem CID 157479216) has the molecular formula C33H25N7O2 and a molecular weight of 551.61 g/mol. Its IUPAC name is 3-amino-N-[(1R)-1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-6-(3H-pyrrol-5-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(1R)-1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-6-(3H-pyrrol-5-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 157479216 |
| Molecular Formula | C33H25N7O2 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 3-amino-N-[(1R)-1-[4-oxo-3-phenyl-5-(2-phenylethynyl)quinazolin-2-yl]ethyl]-6-(3H-pyrrol-5-yl)pyrazine-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nc(C2=CCC=N2)cnc1N)c1nc2cccc(C#Cc3ccccc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C33H25N7O2/c1-21(37-32(41)29-30(34)36-20-27(38-29)25-16-9-19-35-25)31-39-26-15-8-12-23(18-17-22-10-4-2-5-11-22)28(26)33(42)40(31)24-13-6-3-7-14-24/h2-8,10-16,19-21H,9H2,1H3,(H2,34,36)(H,37,41)/t21-/m1/s1 |
| InChIKey | BVYQDFBOQHQENE-OAQYLSRUSA-N |
| XLogP | 4.46 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|