About 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride
2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride (PubChem CID 157479592) has the molecular formula C12H16FN5
and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride.
Molecular Properties
| Compound Name | 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride |
| PubChem CID | 157479592 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride |
| SMILES | CNc1ccccc1/N=N/c1n(C)cc[n+]1C.[F-] |
| InChI | InChI=1S/C12H15N5.FH/c1-13-10-6-4-5-7-11(10)14-15-12-16(2)8-9-17(12)3;/h4-9H,1-3H3;1H |
| InChIKey | BVZVOLNETMPCNT-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride?
The IUPAC name of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride (CID 157479592) is 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride.
What is the SMILES notation for 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride?
The canonical SMILES for 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride is CNc1ccccc1/N=N/c1n(C)cc[n+]1C.[F-].
What is the InChIKey of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride?
The InChIKey is BVZVOLNETMPCNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5.FH/c1-13-10-6-4-5-7-11(10)14-15-12-16(2)8-9-17(12)3;/h4-9H,1-3H3;1H.
What are the key properties of 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride?
2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride has a molecular weight of 249.29 g/mol, XLogP of -0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N-methylaniline fluoride is sourced from PubChem (CID 157479592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).