About N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide
N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide (PubChem CID 157479983) has the molecular formula C20H25FN4O2S
and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide |
| PubChem CID | 157479983 |
| Molecular Formula | C20H25FN4O2S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide |
| SMILES | Cc1cc2ncc(C#N)c(N3CCCC(F)(CNS(C)(=O)=O)CC3)c2cc1C |
| InChI | InChI=1S/C20H25FN4O2S/c1-14-9-17-18(10-15(14)2)23-12-16(11-22)19(17)25-7-4-5-20(21,6-8-25)13-24-28(3,26)27/h9-10,12,24H,4-8,13H2,1-3H3 |
| InChIKey | IVDNVIXMUNLDAP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide (CID 157479983) is N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide is Cc1cc2ncc(C#N)c(N3CCCC(F)(CNS(C)(=O)=O)CC3)c2cc1C.
What is the InChIKey of N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide?
The InChIKey is IVDNVIXMUNLDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN4O2S/c1-14-9-17-18(10-15(14)2)23-12-16(11-22)19(17)25-7-4-5-20(21,6-8-25)13-24-28(3,26)27/h9-10,12,24H,4-8,13H2,1-3H3.
What are the key properties of N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide?
N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide has a molecular weight of 404.51 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(3-cyano-6,7-dimethylquinolin-4-yl)-4-fluoroazepan-4-yl]methyl]methanesulfonamide is sourced from PubChem (CID 157479983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).