C22H39BrN4OSi — CID 157480454
(19-bromo-2,15,17,20-tetrazabicyclo[14.3.1]icosa-1(20),11,16,18-tetraen-7-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 157480454) has the molecular formula C22H39BrN4OSi and a molecular weight of 483.57 g/mol. Its IUPAC name is (19-bromo-2,15,17,20-tetrazabicyclo[14.3.1]icosa-1(20),11,16,18-tetraen-7-yl)oxy-tert-butyl-dimethylsilane.
| Compound Name | (19-bromo-2,15,17,20-tetrazabicyclo[14.3.1]icosa-1(20),11,16,18-tetraen-7-yl)oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 157480454 |
| Molecular Formula | C22H39BrN4OSi |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (19-bromo-2,15,17,20-tetrazabicyclo[14.3.1]icosa-1(20),11,16,18-tetraen-7-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC=CCCNc2ncc(Br)c(n2)NCCCC1 |
| InChI | InChI=1S/C22H39BrN4OSi/c1-22(2,3)29(4,5)28-18-13-9-7-6-8-11-16-25-21-26-17-19(23)20(27-21)24-15-12-10-14-18/h6,8,17-18H,7,9-16H2,1-5H3,(H2,24,25,26,27) |
| InChIKey | ZKIRDVMWNDDVET-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|