About 2,4-dimethylpentane;propane;prop-1-ene
2,4-dimethylpentane;propane;prop-1-ene (PubChem CID 157480541) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is 2,4-dimethylpentane;propane;prop-1-ene.
Molecular Properties
| Compound Name | 2,4-dimethylpentane;propane;prop-1-ene |
| PubChem CID | 157480541 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | 2,4-dimethylpentane;propane;prop-1-ene |
| SMILES | C=CC.CC(C)CC(C)C.CCC |
| InChI | InChI=1S/C7H16.C3H8.C3H6/c1-6(2)5-7(3)4;2*1-3-2/h6-7H,5H2,1-4H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | BWCLODBPDDGDDQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpentane;propane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentane;propane;prop-1-ene?
The IUPAC name of 2,4-dimethylpentane;propane;prop-1-ene (CID 157480541) is 2,4-dimethylpentane;propane;prop-1-ene.
What is the SMILES notation for 2,4-dimethylpentane;propane;prop-1-ene?
The canonical SMILES for 2,4-dimethylpentane;propane;prop-1-ene is C=CC.CC(C)CC(C)C.CCC.
What is the InChIKey of 2,4-dimethylpentane;propane;prop-1-ene?
The InChIKey is BWCLODBPDDGDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C3H8.C3H6/c1-6(2)5-7(3)4;2*1-3-2/h6-7H,5H2,1-4H3;3H2,1-2H3;3H,1H2,2H3.
What are the key properties of 2,4-dimethylpentane;propane;prop-1-ene?
2,4-dimethylpentane;propane;prop-1-ene has a molecular weight of 186.38 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentane;propane;prop-1-ene is sourced from PubChem (CID 157480541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).