C21H18N6OS — CID 157480618
2-[2-[9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-5-methyl-1,3-thiazole (PubChem CID 157480618) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[2-[9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[2-[9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 157480618 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[2-[9-(methoxymethyl)-15-methyl-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaen-5-yl]ethynyl]-5-methyl-1,3-thiazole |
| SMILES | COCc1nnc2n1Cc1c(C#Cc3ncc(C)s3)ncn1-c1ccc(C)cc1-2 |
| InChI | InChI=1S/C21H18N6OS/c1-13-4-6-17-15(8-13)21-25-24-19(11-28-3)26(21)10-18-16(23-12-27(17)18)5-7-20-22-9-14(2)29-20/h4,6,8-9,12H,10-11H2,1-3H3 |
| InChIKey | GDKRONMMOJIIQC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|